7-(2,3-Dihydroxypropyl)theophylline , 99% , 479-18-5
Synonym(s):
Dyphylline;Diprophylline;7-(2,3-Dihydroxypropyl)theophylline;9-(1,3-Benzodioxol-5-yl)-4-hydroxy-6,7-dimethoxy-naphtho[2,3-c]furan-1(3H)-one;7-(2,3-Dihydroxypropyl)-3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione
CAS NO.:479-18-5
Empirical Formula: C10H14N4O4
Molecular Weight: 254.24
MDL number: MFCD00005759
EINECS: 207-526-1
| Pack Size | Price | Stock | Quantity |
| 25g | RMB46.40 | In Stock |
|
| 100G | RMB132.80 | In Stock |
|
| 500G | RMB512.80 | In Stock |
|
| 2.5kg | RMB1923.20 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 161-162 °C(lit.) |
| Boiling point: | 397.46°C (rough estimate) |
| Density | 1.3036 (rough estimate) |
| refractive index | 1.6200 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Freely soluble in water, slightly soluble in ethanol (96 per cent). |
| form | Powder |
| pka | 13.74±0.20(Predicted) |
| color | White |
| Water Solubility | 33 g/100 mL (25 ºC) |
| Merck | 14,3479 |
| BRN | 284563 |
| Stability: | Hygroscopic |
| Cosmetics Ingredients Functions | SKIN CONDITIONING |
| InChI | 1S/C10H14N4O4/c1-12-8-7(9(17)13(2)10(12)18)14(5-11-8)3-6(16)4-15/h5-6,15-16H,3-4H2,1-2H3 |
| InChIKey | KSCFJBIXMNOVSH-UHFFFAOYSA-N |
| SMILES | CN1C(=O)N(C)c2ncn(CC(O)CO)c2C1=O |
| LogP | -1.100 (est) |
| CAS DataBase Reference | 479-18-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Dyphylline(479-18-5) |
| EPA Substance Registry System | Dyphylline (479-18-5) |
Description and Uses
Dyphylline is the N-7 dihydroxypropyl derivative of theophylline and is not a theophylline salt. Dyphylline does not get metabolized to theophylline in vivo, and even though it contains 70% theophylline by molecular weight ratio, the equivalent amount to theophylline is not known. Dosing must be accomplished independently by monitoring dyphylline blood levels. Dyphylline has a diminished bronchodilator effect compared to theophylline, but it may have lower and less serious side effects. Dosage forms available are an elixir and tablets.
An adenosine receptor antagonist, phosphodiesterase inhibitor and vasodilator
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P301+P312+P330 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 36-36/37-26 |
| WGK Germany | 3 |
| RTECS | XH5100000 |
| TSCA | TSCA listed |
| HS Code | 29395900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
| Hazardous Substances Data | 479-18-5(Hazardous Substances Data) |
| Toxicity | LD50 in mice (mg/kg): 3400 orally; 1430 s.c. (Al'tshuler) |




