A3174612
2,6-Dichloro-3-nitropyridine , 97% , 16013-85-7
CAS NO.:16013-85-7
Empirical Formula: C5H2Cl2N2O2
Molecular Weight: 192.99
MDL number: MFCD00006234
EINECS: 240-151-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB38.40 | In Stock |
|
| 25G | RMB97.60 | In Stock |
|
| 100G | RMB415.20 | In Stock |
|
| 500g | RMB1653.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 55-60 °C(lit.) |
| Boiling point: | 295.5±35.0 °C(Predicted) |
| Density | 1.6791 (rough estimate) |
| refractive index | 1.6100 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | Liquid |
| pka | -5.76±0.10(Predicted) |
| color | Clear colorless to light yellow |
| BRN | 1619741 |
| InChI | InChI=1S/C5H2Cl2N2O2/c6-4-2-1-3(9(10)11)5(7)8-4/h1-2H |
| InChIKey | SHCWQWRTKPNTEM-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC(Cl)=CC=C1[N+]([O-])=O |
| CAS DataBase Reference | 16013-85-7(CAS DataBase Reference) |
Description and Uses
2,6-Dichloro-3-nitropyridine was used:
- in the synthesis of pyridyldifluoroacetates
- as starting reagent in the preparation of bicyclooxacalixhetarene
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H317-H319-H335 |
| Precautionary statements | P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-42/43-43 |
| Safety Statements | 22-26-36/37-37/39-24-36/37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |





![5-[[(4-Fluorophenyl)Methyl]aMino]-1,3-dihydro-2H-iMidazo[4,5-b]pyridin-2-one](https://img.chemicalbook.com/CAS/GIF/951624-49-0.gif)
