A3174812
2,6-Di-tert-butyl-4-methylpyridine , 98% , 38222-83-2
CAS NO.:38222-83-2
Empirical Formula: C14H23N
Molecular Weight: 205.34
MDL number: MFCD00006305
EINECS: 253-834-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB57.60 | In Stock |
|
| 5G | RMB180.80 | In Stock |
|
| 25G | RMB679.20 | In Stock |
|
| 100G | RMB2279.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 33-36 °C (lit.) |
| Boiling point: | 233 °C (lit.) |
| Density | 1,476 g/cm3 |
| refractive index | n |
| Flash point: | 183 °F |
| storage temp. | 2-8°C |
| solubility | ethanol: soluble5%, clear to slightly hazy, colorless to dark yellow |
| form | Liquid or Low Melting Solid |
| pka | 6.88±0.10(Predicted) |
| color | brown |
| Water Solubility | Sparingly soluble in water. Soluble in ethanol, acetic acid and diethyl ether. |
| Sensitive | Air & Light Sensitive |
| BRN | 130503 |
| InChI | 1S/C14H23N/c1-10-8-11(13(2,3)4)15-12(9-10)14(5,6)7/h8-9H,1-7H3 |
| InChIKey | HVHZEKKZMFRULH-UHFFFAOYSA-N |
| SMILES | Cc1cc(nc(c1)C(C)(C)C)C(C)(C)C |
| CAS DataBase Reference | 38222-83-2(CAS DataBase Reference) |
Description and Uses
2,6-Di-tert-butyl-4-methylpyridine has been used:
- in the synthesis of 1,2-dihydro-2-silanaphthalene derivatives
- as base in PtCl4-catalyzed cyclization reactions of homopropargyl azide derivatives
- diastereoselective synthesis of β-thiomannopyranosides
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| F | 8-10-23 |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




