A3175112
2,4-Dichloro-1-fluorobenzene , 99% , 1435-48-9
CAS NO.：1435-48-9
Empirical Formula: C6H3Cl2F
Molecular Weight: 164.99
MDL number: MFCD00000580
EINECS: 406-160-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB74.72 | In Stock |
|
| 50g | RMB151.20 | In Stock |
|
| 100G | RMB297.60 | In Stock |
|
| 500g | RMB695.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -23 °C |
| Boiling point: | 172-174 °C(lit.) |
| Density | 1.409 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 98 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Specific Gravity | 1.409 |
| Water Solubility | insoluble |
| BRN | 2500791 |
| InChI | InChI=1S/C6H3Cl2F/c7-4-1-2-6(9)5(8)3-4/h1-3H |
| InChIKey | BDJZCCWUSOZUQG-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=C(Cl)C=C1Cl |
| CAS DataBase Reference | 1435-48-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,3-Dichloro-4-fluorobenzene(1435-48-9) |
Description and Uses
1, 3-dichloro-4-fluorobenzene is a multifunctional chemical reagent. Its benzene ring structure formula contains fluorine and chlorine functional groups and can be used in various reaction systems. It is widely applied in the field of organic synthesis.
Safety
| Symbol(GHS) |     GHS02,GHS07,GHS09,GHS08 |
| Signal word | Warning |
| Hazard statements | H226-H302-H315-H411-H227-H373 |
| Precautionary statements | P210-P233-P240-P241+P242+P243-P264-P270-P273-P280-P301+P312+P330-P302+P352+P332+P313+P362+P364-P391-P403+P235-P501-P210e-P260-P280a-P301+P312a-P501a |
| Hazard Codes | Xn,N,Xi |
| Risk Statements | 22-38-48/20/22-51/53-10-36/37/38 |
| Safety Statements | 36/37-61-16-36-26 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29039990 |
