A3175312
4,6-Dimethoxy-2-(methylsulfonyl)pyrimidine , 98% , 113583-35-0
CAS NO.：113583-35-0
Empirical Formula: C7H10N2O4S
Molecular Weight: 218.23
MDL number: MFCD00672151
EINECS: 601-266-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB25.60 | In Stock |
|
| 5G | RMB36.80 | In Stock |
|
| 25G | RMB48.80 | In Stock |
|
| 100G | RMB112.80 | In Stock |
|
| 500G | RMB452.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 129-133 °C(lit.) |
| Boiling point: | 412.6±48.0 °C(Predicted) |
| Density | 1.317±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | -3.39±0.30(Predicted) |
| color | Whtie |
| InChI | InChI=1S/C7H10N2O4S/c1-12-5-4-6(13-2)9-7(8-5)14(3,10)11/h4H,1-3H3 |
| InChIKey | ITDVJJVNAASTRS-UHFFFAOYSA-N |
| SMILES | C1(S(C)(=O)=O)=NC(OC)=CC(OC)=N1 |
| CAS DataBase Reference | 113583-35-0(CAS DataBase Reference) |
Description and Uses
4,6-Dimethoxy-2-(methylsulfonyl)pyrimidine may be used in the microwave assisted preparation of 4,6-dimethoxy-N-methylpyrimidin-2-amine by reacting with methylamine. It may also be used to prepare 2′-pyrimidinecarbonylsulfonanilide derivatives with potent herbicidal activity.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29335990 |
