A3175512
5,5-Diphenylhydantoin sodium salt , 98% , 630-93-3
Synonym(s):
5,5-Diphenyl-2,4-imidazolidinedione;5,5-Diphenylhydantoin sodium salt;Phenytoin
CAS NO.：630-93-3
Empirical Formula: C15H13N2NaO2
Molecular Weight: 276.27
MDL number: MFCD00069674
EINECS: 211-148-2
| Pack Size | Price | Stock | Quantity |
| 25G | RMB40.80 | In Stock |
|
| 100G | RMB116.00 | In Stock |
|
| 500G | RMB492.80 | In Stock |
|
| 2.5kg | RMB2274.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | aqueous base: soluble |
| form | Crystalline Powder |
| color | White to almost white |
| Merck | 14,7322 |
| BCS Class | 2 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C15H12N2O2.Na.H/c18-13-15(17-14(19)16-13,11-7-3-1-4-8-11)12-9-5-2-6-10-12;;/h1-10H,(H2,16,17,18,19);; |
| InChIKey | FJPYVLNWWICYDW-UHFFFAOYSA-M |
| SMILES | O=C1NC(=O)NC1(C1C=CC=CC=1)C1C=CC=CC=1.[NaH] |
| CAS DataBase Reference | 630-93-3(CAS DataBase Reference) |
| EPA Substance Registry System | Diphenylhydantoin sodium (630-93-3) |
Description and Uses
antibacterial
Safety
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302-H317-H361 |
| Precautionary statements | P201-P202-P280-P301+P312-P302+P352-P308+P313 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | Xn |
| Risk Statements | 22-43-62-63 |
| Safety Statements | 22-36/37/39-45 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | MU1400000 |
| TSCA | TSCA listed |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29332100 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Repr. 2 Skin Sens. 1 |
| Toxicity | LD50 orally in mice: 490 mg/kg (Fink, Swinyard) |
