A3175712
D-Allylglycine , 98% , 54594-06-8
Synonym(s):
(R)-(+)-2-Amino-4-pentenoic acid;D -2-Amino-4-pentenoic acid
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB114.40 | In Stock |
|
| 1G | RMB289.60 | In Stock |
|
| 5g | RMB912.00 | In Stock |
|
| 25g | RMB2746.40 | In Stock |
|
| 100g | RMB7759.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 239.3-241.2 °C |
| Boiling point: | 231.0±33.0 °C(Predicted) |
| alpha | 37 º (c=2% in H2O) |
| Density | 1.098±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| solubility | Water (Slightly) |
| form | Solid |
| pka | 2.22±0.10(Predicted) |
| color | White to Light Beige |
| BRN | 1721511 |
| Stability: | Light Sensitive |
| InChI | InChI=1S/C5H9NO2/c1-2-3-4(6)5(7)8/h2,4H,1,3,6H2,(H,7,8)/t4-/m1/s1 |
| InChIKey | WNNNWFKQCKFSDK-SCSAIBSYSA-N |
| SMILES | C(O)(=O)[C@H](N)CC=C |
| CAS DataBase Reference | 54594-06-8(CAS DataBase Reference) |
Description and Uses
D-Allylglycine is a new chiral glycine equivalent, it is used for the preparation of enantiomerically pure a-tertiary and a-quaternary a-amino acids. A Bacillus spore germination alanine analog.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301+H311+H331-H315-H319 |
| Precautionary statements | P501-P261-P270-P271-P264-P280-P337+P313-P305+P351+P338-P361+P364-P332+P313-P301+P310+P330-P302+P352+P312-P304+P340+P311-P403+P233-P405 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-36-26 |
| WGK Germany | 3 |
| HS Code | 29224999 |
