A3175912
3,3-Diphenyl-D-alanine , 98% , 149597-91-1
Synonym(s):
β-Phenyl-D -phenylalanine;(R)-2-Amino-3,3-diphenylpropionic acid
| Pack Size | Price | Stock | Quantity |
| 1G | RMB386.40 | In Stock |
|
| 5G | RMB1496.00 | In Stock |
|
| 10g | RMB2682.40 | In Stock |
|
| 25g | RMB5364.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 389.2±30.0 °C(Predicted) |
| Density | 1.198±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | powder |
| pka | 2.11±0.10(Predicted) |
| Appearance | White to off-white Solid |
| optical activity | Consistent with structure |
| BRN | 4906961 |
| Major Application | peptide synthesis |
| InChI | 1S/C15H15NO2/c16-14(15(17)18)13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13-14H,16H2,(H,17,18)/t14-/m1/s1 |
| InChIKey | PECGVEGMRUZOML-CQSZACIVSA-N |
| SMILES | N[C@H](C(c1ccccc1)c2ccccc2)C(O)=O |
| CAS DataBase Reference | 149597-91-1(CAS DataBase Reference) |
Description and Uses
3,3-Diphenyl-D-alanine is used in the coupling of diphenylalanine with D-leucine Methyl ester.
Safety
| Symbol(GHS) | ![]() ![]() GHS03,GHS07 |
| Signal word | Warning |
| Hazard statements | H272-H315-H319-H335 |
| Precautionary statements | P221-P261-P264b-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P362+P364-P370+P378r-P403+P233-P501c |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| WGK Germany | 3 |
| HS Code | 2922498590 |
| Storage Class | 11 - Combustible Solids |








