A3176312
2-Deoxy-D-galactose , 98% , 1949-89-9
Synonym(s):
2-Deoxy-D -lyxohexose;2-Deoxy-D-galactose - CAS 1949-89-9 - Calbiochem
CAS NO.:1949-89-9
Empirical Formula: C6H12O5
Molecular Weight: 164.16
MDL number: MFCD00014649
EINECS: 217-765-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB392.00 | In Stock |
|
| 5G | RMB1414.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 107-110 °C(lit.) |
| alpha | 57 º (c=3.7, H20 NH3) |
| Boiling point: | 211.61°C (rough estimate) |
| Density | 1.1738 (rough estimate) |
| refractive index | 1.4230 (estimate) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Methanol, Water |
| form | Powder |
| pka | 13.47±0.20(Predicted) |
| color | White to Off-white |
| optical activity | [α]20/D +59.7°, c = 2 in H2O |
| Water Solubility | Soluble in water. |
| BRN | 1723333 |
| InChI | 1S/C6H12O5/c7-2-4-6(10)3(8)1-5(9)11-4/h3-10H,1-2H2/t3-,4-,5,6-/m1/s1 |
| InChIKey | PMMURAAUARKVCB-DUVQVXGLSA-N |
| SMILES | OC[C@H]1OC(O)C[C@@H](O)[C@H]1O |
| LogP | -3.070 (est) |
| CAS DataBase Reference | 1949-89-9(CAS DataBase Reference) |
| EPA Substance Registry System | D-lyxo-Hexose, 2-deoxy- (1949-89-9) |
Description and Uses
2-Deoxy-D-galactose is used as an inhibitor of fucosylation, which is a process of adding hexose deoxy sugar units to a molecule. It is used for studying galactose uptake into Escherichia coli and also for competitive elution of Anadarin P lectin (a galactosyl-binding lectin from blood clam).
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H302-H315-H317-H319-H335-H411-H372 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi,Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 24/25-37/39-36-26 |
| WGK Germany | 3 |
| F | 3-10 |
| HS Code | 29400090 |
| Storage Class | 11 - Combustible Solids |






![2-[2-(2-Azidoethoxy)ethoxy]ethyl 2,3,4,6-Tetra-<i>O</i>-acetyl-<small>D</small>-galactopyranoside](https://img.chemicalbook.com/CAS/GIF/381716-33-2.gif)

