A3178412
N,N-Diphenylcarbamyl chloride , 98% , 83-01-2
Synonym(s):
Chloroformic acid diphenylamide;Diphenylcarbamic chloride;Diphenylcarbamoyl chloride;NSC 6788
CAS NO.:83-01-2
Empirical Formula: C13H10ClNO
Molecular Weight: 231.68
MDL number: MFCD00000633
EINECS: 201-450-2
| Pack Size | Price | Stock | Quantity |
| 5g | RMB24.80 | In Stock |
|
| 25G | RMB74.40 | In Stock |
|
| 100G | RMB201.60 | In Stock |
|
| 500G | RMB864.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 83-85 °C |
| Boiling point: | 207°C (rough estimate) |
| Density | 1.1781 (rough estimate) |
| refractive index | 1.6330 (estimate) |
| storage temp. | 2-8°C |
| solubility | organic solvents: soluble |
| pka | -4.13±0.50(Predicted) |
| form | Crystalline Powder |
| color | Beige to gray-green |
| Water Solubility | reacts |
| Sensitive | Moisture Sensitive |
| BRN | 515312 |
| InChI | 1S/C13H10ClNO/c14-13(16)15(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
| InChIKey | XNBKKRFABABBPM-UHFFFAOYSA-N |
| SMILES | ClC(=O)N(c1ccccc1)c2ccccc2 |
| CAS DataBase Reference | 83-01-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Diphenylcarbamoyl chloride(83-01-2) |
| EPA Substance Registry System | Carbamic chloride, diphenyl- (83-01-2) |
Description and Uses
N,N-Diphenylcarbamyl Chloride (Temozolomide USP Related Compound C) is used in the production of a high performance polyamide used as an electrical switch for memory devices. Also used in the synthesis of modified oligoribonucleotides base pairs.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H314-H317 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34-43-29 |
| Safety Statements | 26-36/37/39-45-28A |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| RTECS | EY5065000 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29242995 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B Skin Sens. 1 |




