A3182212
Diethylenetriaminepentaacetic acid , AR,≥99%(titration) , 67-43-6
Synonym(s):
DTPA;Diethylenetriaminepentaacetic acid;Pentetic acid;Titriplex V;DETAPAC
CAS NO.:67-43-6
Empirical Formula: C14H23N3O10
Molecular Weight: 393.35
MDL number: MFCD00004289
EINECS: 200-652-8
| Pack Size | Price | Stock | Quantity |
| 25G | RMB23.20 | In Stock |
|
| 100G | RMB57.60 | In Stock |
|
| 500G | RMB182.40 | In Stock |
|
| 2.5KG | RMB665.60 | In Stock |
|
| 10kg | RMB1955.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 219-220 °C (lit.) |
| Boiling point: | 517.84°C (rough estimate) |
| Density | 1.56 |
| bulk density | 580kg/m3 |
| refractive index | 1.5700 (estimate) |
| Flash point: | 200 °C |
| storage temp. | room temp |
| solubility | 0.1 M NaOH: 0.1 M at 20 °C, clear, colorless |
| pka | pK1:;pK2:2.55(+1);pK3:4.33(+2);pK4:8.60(-3);pK5,10.58 (25°C) |
| form | Crystalline Powder |
| color | White to almost white |
| PH | 2-3 (H2O, 20℃)(saturated solution) |
| biological source | synthetic (organic) |
| Water Solubility | 5 g/L (20 ºC) |
| Merck | 14,7125 |
| BRN | 1810219 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Cosmetics Ingredients Functions | CHELATING |
| InChI | 1S/C14H23N3O10/c18-10(19)5-15(1-3-16(6-11(20)21)7-12(22)23)2-4-17(8-13(24)25)9-14(26)27/h1-9H2,(H,18,19)(H,20,21)(H,22,23)(H,24,25)(H,26,27) |
| InChIKey | QPCDCPDFJACHGM-UHFFFAOYSA-N |
| SMILES | OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CCN(CC(O)=O)CC(O)=O |
| LogP | -1.361 (est) |
| CAS DataBase Reference | 67-43-6(CAS DataBase Reference) |
| NIST Chemistry Reference | N,N-Bis(2-(bis-(carboxymethyl)amino)ethyl)-glycine(67-43-6) |
| EPA Substance Registry System | Pentetic acid (67-43-6) |
Description and Uses
chelating agent, diagnostic aid
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H319-H332-H361fd-H373 |
| Precautionary statements | P201-P202-P260-P304+P340+P312-P305+P351+P338-P308+P313 |
| target organs | Respiratory Tract |
| Hazard Codes | Xi,N,Xn |
| Risk Statements | 36-51/53-36/37/38-20-63 |
| Safety Statements | 26-36-61-37/39-36/37 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 2 |
| RTECS | MB8205000 |
| F | 3 |
| TSCA | TSCA listed |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29224995 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Inhalation Eye Irrit. 2 Repr. 1B STOT RE 2 Inhalation |
| Toxicity | LD50 orally in Rabbit: > 2000 mg/kg |







