A3183612
Dimethyl maleate , 98% , 624-48-6
CAS NO.:624-48-6
Empirical Formula: C6H8O4
Molecular Weight: 144.13
MDL number: MFCD00008459
EINECS: 210-848-5
| Pack Size | Price | Stock | Quantity |
| 25G | RMB26.40 | In Stock |
|
| 100G | RMB33.60 | In Stock |
|
| 250g | RMB71.20 | In Stock |
|
| 500G | RMB112.80 | In Stock |
|
| 2.5KG | RMB479.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -19°C |
| Boiling point: | 204-205 °C(lit.) |
| Density | 1.152 g/mL at 25 °C(lit.) |
| vapor pressure | 48Pa at 25℃ |
| refractive index | n |
| Flash point: | 196 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | water: soluble77.9g/L at 20°C |
| form | Liquid |
| color | Clear |
| Odor | mild char. odor |
| Water Solubility | Miscible with water. |
| BRN | 471705 |
| Stability: | Stable. Combustible. Incompatible with acids, bases, reducing agents, strong oxidizing agents. |
| Cosmetics Ingredients Functions | SOLVENT SKIN CONDITIONING - EMOLLIENT |
| InChI | 1S/C6H8O4/c1-9-5(7)3-4-6(8)10-2/h3-4H,1-2H3/b4-3- |
| InChIKey | LDCRTTXIJACKKU-ARJAWSKDSA-N |
| SMILES | [H]\C(=C(/[H])C(=O)OC)C(=O)OC |
| LogP | 0.52 at 35℃ |
| CAS DataBase Reference | 624-48-6(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Butenedioic acid (Z)-, dimethyl ester(624-48-6) |
| EPA Substance Registry System | 2-Butenedioic acid (2Z)-, dimethyl ester (624-48-6) |
Description and Uses
Dimethyl maleate is acts as a dienophile involved in ultrasonic irradiation promoted Diels-Alder reaction with substituted furans. It is widely used as an intermediate and additive for pharmaceuticals, copolymers, pigments, plastics, paints, adhesives and agrochemicals. As an internal modifier, it increases the glass transition temperature of styrene or vinyl chloride polymer. It plays a vital role to improve the hardness and toughness of polymer films such as copolymers of vinyl acetate.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302-H317-H319-H335-H373 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338-P314 |
| target organs | Respiratory system, Skin |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn,C |
| Risk Statements | 21/22-36/37/38-43-37-34-22 |
| Safety Statements | 26-36/37-23-45-36/37/39 |
| RIDADR | UN 2810 6.1/PG 3 |
| WGK Germany | 1 |
| RTECS | EM6300000 |
| TSCA | TSCA listed |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29171990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 4 Oral Eye Irrit. 2 Skin Sens. 1 STOT RE 2 Dermal STOT SE 3 |





