A3184112
Dicyclohexyl phthalate , 99% , 84-61-7
Synonym(s):
Dicyclohexyl phthalate;Phthalic acid dicyclohexyl ester
CAS NO.:84-61-7
Empirical Formula: C20H26O4
Molecular Weight: 330.42
MDL number: MFCD00003849
EINECS: 201-545-9
| Pack Size | Price | Stock | Quantity |
| 100G | RMB33.60 | In Stock |
|
| 250g | RMB71.20 | In Stock |
|
| 500G | RMB108.80 | In Stock |
|
| 2.5kg | RMB388.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 63-67 °C(lit.) |
| Boiling point: | 200-235 °C (4 mmHg) |
| Density | 1.2 |
| bulk density | 710kg/m3 |
| vapor density | 11.6 (vs air) |
| vapor pressure | 0.1 mm Hg ( 150 °C) |
| refractive index | 1.485 |
| Flash point: | 207 °C |
| storage temp. | Store below +30°C. |
| solubility | 0.2mg/l |
| form | Solid |
| color | White |
| Odor | at 100.00%. mild plastic |
| Water Solubility | insoluble |
| BRN | 1889288 |
| InChI | 1S/C20H26O4/c21-19(23-15-9-3-1-4-10-15)17-13-7-8-14-18(17)20(22)24-16-11-5-2-6-12-16/h7-8,13-16H,1-6,9-12H2 |
| InChIKey | VOWAEIGWURALJQ-UHFFFAOYSA-N |
| SMILES | O=C(OC1CCCCC1)c2ccccc2C(=O)OC3CCCCC3 |
| LogP | 4.82 at 25℃ |
| CAS DataBase Reference | 84-61-7(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,2-Benzenedicarboxylic acid, dicyclohexyl ester(84-61-7) |
| EPA Substance Registry System | Dicyclohexyl phthalate (84-61-7) |
Description and Uses
Dicyclohexyl Phthalate is a phthalate ester used as a plasticizer as well as being present in cosmetic products. Dicyclohexyl Phthalate that is a weak drug-type inducer of hepatic xenobiotic metabolism.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H317-H360D-H412 |
| Precautionary statements | P201-P202-P273-P280-P302+P352-P308+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 1 |
| RTECS | TI0889000 |
| Autoignition Temperature | 395°C |
| TSCA | TSCA listed |
| HS Code | 29173400 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Aquatic Chronic 2 Repr. 1B Skin Sens. 1 |
| Hazardous Substances Data | 84-61-7(Hazardous Substances Data) |
| Toxicity | LD50 oral in rat: 30mL/kg |




