A3185412
2,6-Diaminopurine , 98% , 5451-40-1
CAS NO.:5451-40-1
Empirical Formula: C5H2Cl2N4
Molecular Weight: 189
MDL number: MFCD09749894
EINECS: 226-681-6
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB20.00 | In Stock |
|
| 1G | RMB30.40 | In Stock |
|
| 5G | RMB55.20 | In Stock |
|
| 25g | RMB192.80 | In Stock |
|
| 100g | RMB716.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 185-195 °C (dec.) (lit.) |
| Boiling point: | 310.62°C (rough estimate) |
| Density | 1.7265 (rough estimate) |
| refractive index | 1.6300 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble |
| pka | 5.22±0.20(Predicted) |
| form | Crystalline Powder |
| color | White to yellow |
| Water Solubility | soluble |
| BRN | 9354 |
| InChI | InChI=1S/C5H2Cl2N4/c6-3-2-4(9-1-8-2)11-5(7)10-3/h1H,(H,8,9,10,11) |
| InChIKey | RMFWVOLULURGJI-UHFFFAOYSA-N |
| SMILES | N1C2C(=NC(Cl)=NC=2Cl)NC=1 |
| CAS DataBase Reference | 5451-40-1(CAS DataBase Reference) |
Description and Uses
2,6-Dichloropurine is an important pharmaceutical intermediate. It is widely used in the preparation of purine nucleosides and purine nucleotides[1].
2,6-Dichloropurine is used in the synthesis of 2,6-diamino-substituted purine derivatives as potential cardiomyogenesis inducing agents.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P264-P270-P301+P310-P405-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 22-24/25-37/39-26-36 |
| RIDADR | UN2811 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29349990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |





