A3186812
Sodium 2,6-dichloroindophenolate hydrate , >95.0%(T) , 620-45-1
CAS NO.：620-45-1
Empirical Formula: C12H6Cl2NNaO2
Molecular Weight: 290.08
MDL number: MFCD00012176
EINECS: 210-640-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB85.60 | In Stock |
|
| 5G | RMB191.20 | In Stock |
|
| 25G | RMB728.80 | In Stock |
|
| 100G | RMB2719.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300°C |
| vapor density | 11.2 (vs air) |
| storage temp. | Store at room temperature. |
| form | Powder/Solid |
| color | Dark green |
| Odor | Odorless |
| Water Solubility | Soluble in water. |
| Sensitive | Light Sensitive |
| Merck | 14,3068 |
| BRN | 3641229 |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong reducing agents. Air and moisture sensitive. Hygroscopic. |
| InChI | InChI=1S/C12H7Cl2NO2.Na.H/c13-10-5-8(6-11(14)12(10)17)15-7-1-3-9(16)4-2-7;;/h1-6,16H;; |
| InChIKey | BKUKEFKAUWOESM-UHFFFAOYSA-N |
| SMILES | N(/C1C=CC(O)=CC=1)=C1/C=C(Cl)C(=O)C(Cl)=C/1.[NaH] |
| CAS DataBase Reference | 620-45-1(CAS DataBase Reference) |
| EPA Substance Registry System | 2,5-Cyclohexadien-1-one, 2,6-dichloro-4-[(4-hydroxyphenyl)imino]-, sodium salt (620-45-1) |
Description and Uses
A redox indicator dye.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-36-26 |
| WGK Germany | 3 |
| RTECS | GU5495000 |
| F | 8 |
| TSCA | Yes |
| HS Code | 29252000 |
