A3187512
Dicyclohexylamine nitrite , 97% , 3129-91-7
Synonym(s):
Dicyclohexylamine nitrite
CAS NO.:3129-91-7
Empirical Formula: C12H24N2O2
Molecular Weight: 228.33
MDL number: MFCD00013128
EINECS: 221-515-9
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 182-183 °C (dec.) (lit.) |
| Boiling point: | 370.15°C (rough estimate) |
| Density | 1.0136 (rough estimate) |
| vapor pressure | 3.3 mm Hg ( 25 °C) |
| refractive index | 1.4560 (estimate) |
| storage temp. | 2-8°C |
| Water Solubility | Soluble in water |
| form | powder to crystal |
| color | White to Almost white |
| BRN | 3711911 |
| InChI | InChI=1S/C12H23N.HNO2/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;2-1-3/h11-13H,1-10H2;(H,2,3) |
| InChIKey | ZFAKTZXUUNBLEB-UHFFFAOYSA-N |
| SMILES | C1(NC2CCCCC2)CCCCC1.N(=O)O |
| CAS DataBase Reference | 3129-91-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Dicyclohexyl ammonium nitrite(3129-91-7) |
| EPA Substance Registry System | Dicyclohexylamine nitrite (3129-91-7) |
Description and Uses
Dicyclohexylamine nitrite is a flammable whitepowder which has some volatility at room temperature andhigher. Molecular weight=228.38; Melting point=181℃;Flash point=185℃. Partly soluble in water.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H228-H302+H332 |
| Precautionary statements | P210-P240-P241-P261-P301+P312-P304+P340+P312 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/22 |
| Safety Statements | 15-41 |
| RIDADR | UN 2687 4.1/PG 3 |
| WGK Germany | 1 |
| RTECS | HY4200000 |
| TSCA | TSCA listed |
| HazardClass | 4.1 |
| PackingGroup | III |
| HS Code | 29251900 |
| Storage Class | 4.1B - Flammable solid hazardous materials |
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Flam. Sol. 2 |
| Toxicity | LD50 oral in rat: 330mg/kg |
| Limited Quantities | 5.0 Kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |






