A3190512
Di-tert-butyl malonate , 97% , 541-16-2
CAS NO.:541-16-2
Empirical Formula: C11H20O4
Molecular Weight: 216.27
MDL number: MFCD00008810
EINECS: 208-769-6
| Pack Size | Price | Stock | Quantity |
| 10ML | RMB113.60 | In Stock |
|
| 50ML | RMB272.00 | In Stock |
|
| 250ML | RMB827.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -7--6 °C (lit.) |
| Boiling point: | 110-111 °C/22 mmHg (lit.) |
| Density | 0.966 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 88 °C |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform, Ethyl Acetate |
| form | Liquid |
| pka | 11.87±0.46(Predicted) |
| color | Clear colorless to slightly yellow |
| Water Solubility | It is hardly soluble in water. |
| Merck | 14,3034 |
| BRN | 1781766 |
| InChI | 1S/C11H20O4/c1-10(2,3)14-8(12)7-9(13)15-11(4,5)6/h7H2,1-6H3 |
| InChIKey | CLPHAYNBNTVRDI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CC(=O)OC(C)(C)C |
| CAS DataBase Reference | 541-16-2(CAS DataBase Reference) |
| NIST Chemistry Reference | di-tert-Butyl malonate(541-16-2) |
| EPA Substance Registry System | Propanedioic acid, bis(1,1-dimethylethyl) ester (541-16-2) |
Description and Uses
In the preparation of ketones.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H227-H317 |
| Precautionary statements | P210e-P261-P280a-P321-P403+P235-P501a |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Risk Statements | 36/37/38-24/25 |
| Safety Statements | 23-24/25 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29171910 |
| Storage Class | 10 - Combustible liquids |






