A3191512
Diphenyl sulfone , Analysis of standard products,> 99.5% , 127-63-9
Synonym(s):
Phenyl sulfone
CAS NO.:127-63-9
Empirical Formula: C12H10O2S
Molecular Weight: 218.27
MDL number: MFCD00007548
EINECS: 204-853-1
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB143.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 123-129 °C (lit.) |
| Boiling point: | 379 °C (lit.) |
| Density | 1.36 |
| vapor pressure | 0.001Pa at 50℃ |
| refractive index | 1.5200 (estimate) |
| Flash point: | 184°C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | >14mg/l |
| form | Crystalline Powder |
| color | White |
| Water Solubility | insoluble |
| Merck | 14,3332 |
| BRN | 1910573 |
| Major Application | agriculture environmental |
| InChI | 1S/C12H10O2S/c13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
| InChIKey | KZTYYGOKRVBIMI-UHFFFAOYSA-N |
| SMILES | O=S(=O)(c1ccccc1)c2ccccc2 |
| LogP | 2.61 |
| CAS DataBase Reference | 127-63-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Diphenyl sulfone(127-63-9) |
| EPA Substance Registry System | Diphenylsulfone (127-63-9) |
Description and Uses
Ovicide; acaricide.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P501 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| RTECS | SX2400000 |
| TSCA | TSCA listed |
| HS Code | 29309070 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
| Toxicity | LD50 orally in rats: >2 g/kg, Residue Rev. 36, 240 (1971) |




