A3195912
Dicofol standard solution , analyticalstandard,10ug/mlinpetroleumether , 115-32-2
Synonym(s):
2,2,2-Trichloro-1,1-bis(4-chlorophenyl)ethanol
CAS NO.:115-32-2
Empirical Formula: C14H9Cl5O
Molecular Weight: 370.49
MDL number: MFCD00055271
EINECS: 204-082-0
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 78.5°C |
| Boiling point: | 225°C |
| Density | 1.45 |
| vapor pressure | 5.3 x 10-5 Pa |
| refractive index | 1.6000 (estimate) |
| Flash point: | 11 °C |
| storage temp. | APPROX 4°C |
| solubility | DMSO: Slightly soluble |
| form | A solid |
| pka | 10.70±0.29(Predicted) |
| Water Solubility | Slightly soluble. <0.01 g/100 mL at 22 ºC |
| Merck | 13,3113 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. Hydrolyzes in basic solution. Corrodes some metals. |
| InChI | 1S/C14H9Cl5O/c15-11-5-1-9(2-6-11)13(20,14(17,18)19)10-3-7-12(16)8-4-10/h1-8,20H |
| InChIKey | UOAMTSKGCBMZTC-UHFFFAOYSA-N |
| SMILES | OC(c1ccc(Cl)cc1)(c2ccc(Cl)cc2)C(Cl)(Cl)Cl |
| CAS DataBase Reference | 115-32-2(CAS DataBase Reference) |
| IARC | 3 (Vol. 30, Sup 7) 1987 |
| NIST Chemistry Reference | Acetic acid, [3,5-diiodo-4-(4-hydroxy-3-iodophenoxy) phenyl]-, 2-[diethylamino]ethyl ester, hydrochloride(115-32-2) |
| EPA Substance Registry System | Dicofol (115-32-2) |
Description and Uses
Dicofol is a white or brown waxy solid.Molecular weight=370.48; Flash point=120℃. HazardIdentification (based on NFPA-704 M Rating System):Health 2, Flammability 1, Reactivity 0. Slightly soluble inwater.
Nonsystemic acaricide to control mites in citrus fruits, grapes, cotton, pome and stone fruit.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302+H312-H315-H317-H410 |
| Precautionary statements | P261-P264-P273-P280-P301+P312-P302+P352+P312 |
| Hazard Codes | Xn;N,N,Xn,T,F |
| Risk Statements | 21/22-38-43-50/53-39/23/24/25-23/24/25-11 |
| Safety Statements | 36/37-60-61-45-16-7 |
| RIDADR | UN 2761/3077 |
| WGK Germany | WGK 3 |
| RTECS | DC8400000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Skin Irrit. 2 Skin Sens. 1 |
| Hazardous Substances Data | 115-32-2(Hazardous Substances Data) |
| Toxicity | LD50 in rats (mg/kg): 1495 orally; 1150 i.p. (Brown) |





