A3197612
                    4-[(2,4-Dimethoxyphenyl)(Fmoc-amino)methyl]phenoxyacetic acid , 98% , 145069-56-3
                            Synonym(s):
Rink amide linker
                            
                        
                CAS NO.:145069-56-3
Empirical Formula: C32H29NO7
Molecular Weight: 539.58
MDL number: MFCD00153509
EINECS: 604-455-1
| Pack Size | Price | Stock | Quantity | 
| 1G | RMB32.80 | In Stock | 
                                                 | 
                                        
| 5G | RMB88.00 | In Stock | 
                                                 | 
                                        
| 25G | RMB305.60 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | ~180 °C (dec.) | 
                                    
| storage temp. | 2-8°C | 
                                    
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | 
                                    
| form | Powder | 
                                    
| BRN | 5841553 | 
                                    
| InChIKey | UPMGJEMWPQOACJ-UHFFFAOYSA-N | 
                                    
| SMILES | C(O)(=O)COC1=CC=C(C(C2=CC=C(OC)C=C2OC)NC(OCC2C3C(=CC=CC=3)C3C2=CC=CC=3)=O)C=C1 | 
                                    
| CAS DataBase Reference | 145069-56-3(CAS DataBase Reference) | 
                                    
Description and Uses
Rink amide linker (CAS# 145069-56-3) is a selective aldose reductase inhibitor and a potential antidiabetic drug.
Safety
| Hazard Codes | Xi | 
| Risk Statements | 36/38 | 
| Safety Statements | 22-24/25-37/39-26 | 
| WGK Germany | 3 | 
| HS Code | 29242995 | 

![4-[(2,4-Dimethoxyphenyl)(Fmoc-amino)methyl]phenoxyacetic acid](https://img.chemicalbook.com/CAS/GIF/145069-56-3.gif)

