A3207012
2,2′-Dithiodibenzoic acid , 96% , 119-80-2
Synonym(s):
2,2′-Dithiodibenzoic acid;2-Carboxyphenyl disulfide;Bis(2-carboxyphenyl) disulfide;Dithiosalicylic acid
CAS NO.:119-80-2
Empirical Formula: C14H10O4S2
Molecular Weight: 306.36
MDL number: MFCD00002465
EINECS: 204-352-8
| Pack Size | Price | Stock | Quantity |
| 25G | RMB28.80 | In Stock |
|
| 100G | RMB67.20 | In Stock |
|
| 250G | RMB157.60 | In Stock |
|
| 500G | RMB232.00 | In Stock |
|
| 2.5kg | RMB816.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 287-290 °C(lit.) |
| Boiling point: | 416.97°C (rough estimate) |
| Density | 1.4555 (rough estimate) |
| vapor pressure | 0Pa at 25℃ |
| refractive index | 1.4950 (estimate) |
| storage temp. | Refrigerator |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 3.02±0.36(Predicted) |
| form | Powder |
| color | Brown |
| Water Solubility | insoluble |
| BRN | 2221810 |
| InChI | 1S/C14H10O4S2/c15-13(16)9-5-1-3-7-11(9)19-20-12-8-4-2-6-10(12)14(17)18/h1-8H,(H,15,16)(H,17,18) |
| InChIKey | LBEMXJWGHIEXRA-UHFFFAOYSA-N |
| SMILES | OC(=O)c1ccccc1SSc2ccccc2C(O)=O |
| LogP | 1.61 at 25℃ and pH6.2-6.48 |
| CAS DataBase Reference | 119-80-2(CAS DataBase Reference) |
| EPA Substance Registry System | Benzoic acid, 2,2'-dithiobis- (119-80-2) |
Description and Uses
2,2'-Dithiosalicylic acid is an organosulfur compound produced from dibenzothiophene metabolites that is in turn biodegraded into transient metabolites such as benzoic acid.It is used in the preparation of a new class of anti-HIV-1 agents.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| RTECS | DG9660000 |
| Hazard Note | Harmful/irritant |
| TSCA | TSCA listed |
| HS Code | 29309070 |
| Storage Class | 11 - Combustible Solids |
| Toxicity | LD50 ipr-mus: 367 mg/kg ARZNAD 21,284,71 |




