A3208812
2,4-Dimethyl-1-nitrobenzene , 99% , 89-87-2
Synonym(s):
1,3-Dimethyl-4-nitrobenzene;4-Nitro-m-xylene
CAS NO.:89-87-2
Empirical Formula: C8H9NO2
Molecular Weight: 151.16
MDL number: MFCD00007169
EINECS: 201-947-4
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 7-9 °C(lit.) |
| Boiling point: | 244 °C(lit.) |
| Density | 1.117 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 225 °F |
| storage temp. | Store below +30°C. |
| form | Liquid |
| color | Clear yellow |
| Water Solubility | 133 mg/L (20 ºC) |
| BRN | 1865656 |
| Stability: | Stable. Incompatible with strong bases, strong oxidizing agents. |
| InChI | 1S/C8H9NO2/c1-6-3-4-8(9(10)11)7(2)5-6/h3-5H,1-2H3 |
| InChIKey | BBUPBICWUURTNP-UHFFFAOYSA-N |
| SMILES | Cc1ccc(c(C)c1)[N+]([O-])=O |
| CAS DataBase Reference | 89-87-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 2,4-dimethyl-1-nitro-(89-87-2) |
| EPA Substance Registry System | 4-Nitro-m-xylene (89-87-2) |
Description and Uses
2,4-Dimethyl-1-nitrobenzene is a useful chemical reactant used as a building block used in the preparation of diaryliodonium triflates.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS06 |
| Signal word | Warning |
| Hazard statements | H300+H310+H330-H311-H331-H302 |
| Precautionary statements | P261-P280h-P304+P340-P311a-P501a-P260-P262-P264-P270-P271-P280-P284-P301+P310+P330-P302+P352+P310+P361+P364-P304+P340+P310-P403+P233-P405-P501 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn,T |
| Risk Statements | 22-20/21/22-36/37/38-23/24/25 |
| Safety Statements | 36/37-45-36/37/39-26-13 |
| RIDADR | UN 1665 6.1/PG 2 |
| WGK Germany | 2 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 29042000 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 2 |





