A3212512
2,4-Dinitroaniline , GR,99% , 97-02-9
CAS NO.:97-02-9
Empirical Formula: C6H5N3O4
Molecular Weight: 183.12
MDL number: MFCD00007151
EINECS: 202-553-5
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 177 °C |
| Boiling point: | 316.77°C (rough estimate) |
| Density | 1,61 g/cm3 |
| bulk density | 800kg/m3 |
| vapor pressure | <0.001 hPa ( 25 °C) |
| refractive index | 1.6910 (estimate) |
| Flash point: | 224 °C |
| storage temp. | Flammables area |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | pK1:-14.25(+1) (25°C) |
| form | Crystalline Powder |
| color | Yellow to yellow-green or yellow-brown |
| PH | 7 (1g/L in H2O) |
| Water Solubility | 0.06 g/L (20 ºC) |
| Merck | 14,3270 |
| BRN | 982999 |
| Stability: | Stable. Incompatible with oxidizing agents. May decompose violently at elevated temperatures. |
| InChI | 1S/C6H5N3O4/c7-5-2-1-4(8(10)11)3-6(5)9(12)13/h1-3H,7H2 |
| InChIKey | LXQOQPGNCGEELI-UHFFFAOYSA-N |
| SMILES | Nc1ccc(cc1[N+]([O-])=O)[N+]([O-])=O |
| CAS DataBase Reference | 97-02-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzenamine, 2,4-dinitro-(97-02-9) |
| EPA Substance Registry System | 2,4-Dinitroaniline (97-02-9) |
Description and Uses
2,4-Dinitroaniline is a nitro substituted benzamide derivative with anti-inflammatory activities in vitro.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS06,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H300+H310+H330-H373-H411 |
| Precautionary statements | P262-P264-P273-P280-P302+P352+P310-P304+P340+P310 |
| Hazard Codes | T+,N |
| Risk Statements | 26/27/28-33-51/53 |
| Safety Statements | 28-36/37-45-61-28A |
| RIDADR | UN 1596 6.1/PG 2 |
| WGK Germany | 2 |
| RTECS | BX9100000 |
| Autoignition Temperature | >365°C |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 29214210 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Dermal Acute Tox. 2 Inhalation Acute Tox. 2 Oral Aquatic Chronic 2 STOT RE 2 |
| Hazardous Substances Data | 97-02-9(Hazardous Substances Data) |
| Limited Quantities | 100ml (liquid) or 0.5 Kg (solid) |
| Excepted Quantities | Max Inner Pack (1g or 1ml) and Max Outer Pack (500g or 500ml) |





