A3213212
2,5-Dichlorobenzaldehyde , 98% , 6361-23-5
CAS NO.:6361-23-5
Empirical Formula: C7H4Cl2O
Molecular Weight: 175.01
MDL number: MFCD00156140
EINECS: 228-832-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5G | RMB70.40 | In Stock |
|
| 25G | RMB230.40 | In Stock |
|
| 100G | RMB799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 54-57 °C (lit.) |
| Boiling point: | 231-233 °C |
| Density | 1.3456 (rough estimate) |
| refractive index | 1.5756 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | Crystalline Powder |
| color | White to off-white |
| Sensitive | Air Sensitive |
| BRN | 1635476 |
| InChI | InChI=1S/C7H4Cl2O/c8-6-1-2-7(9)5(3-6)4-10/h1-4H |
| InChIKey | BUXHYMZMVMNDMG-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC(Cl)=CC=C1Cl |
| CAS DataBase Reference | 6361-23-5(CAS DataBase Reference) |
Description and Uses
2,5-Dichlorobenzaldehyde is used as a dye intermediate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,C |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| RIDADR | 1759 |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29130000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





