A3214112
DIPSO sodium salt , 98% , 102783-62-0
Synonym(s):
3-(N,N-Bis[2-hydroxyethyl]amino)-2-hydroxypropanesulfonic acid
CAS NO.:102783-62-0
Empirical Formula: C7H16NNaO6S
Molecular Weight: 265.26
MDL number: MFCD00070010
EINECS: 2017-001-1
| Pack Size | Price | Stock | Quantity |
| 25G | RMB224.80 | In Stock |
|
| 100G | RMB479.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| solubility | water: 0.333 g/L, clear to slightly hazy, colorless |
| form | crystalline powder |
| pka | 7.6(at 25℃) |
| PH Range | 7.0 - 8.2 |
| PH | 7.0-8.2 |
| Water Solubility | water: 0.333g/L, clear to slightly hazy, colorless |
| Major Application | diagnostic assay manufacturing |
| InChI | InChI=1S/C7H17NO6S.Na.H/c9-3-1-8(2-4-10)5-7(11)6-15(12,13)14;;/h7,9-11H,1-6H2,(H,12,13,14);; |
| InChIKey | HKDXASRFOMXBGO-UHFFFAOYSA-N |
| SMILES | N(CCO)(CCO)CC(O)CS(O)(=O)=O.[NaH] |
| CAS DataBase Reference | 102783-62-0(CAS DataBase Reference) |
Description and Uses
diagnostic assay manufacturing
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P271-P280 |
| Hazard Codes | F,Xi |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 7/9-16-26-36 |
| WGK Germany | 3 |
| HS Code | 29225090 |
| Storage Class | 11 - Combustible Solids |




