A3216812
4-(Dimethylamino)cinnamic acid , 99% , 1552-96-1
CAS NO.:1552-96-1
Empirical Formula: C11H13NO2
Molecular Weight: 191.23
MDL number: MFCD00004397
EINECS: 216-299-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB60.00 | In Stock |
|
| 5G | RMB121.60 | In Stock |
|
| 25g | RMB305.60 | In Stock |
|
| 100g | RMB868.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 227-228 °C (dec.)(lit.) |
| Boiling point: | 326.97°C (rough estimate) |
| Density | 1.1258 (rough estimate) |
| refractive index | 1.5220 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| pka | -95.54±0.10(Predicted) |
| form | Crystalline Powder |
| color | Yellow to beige |
| BRN | 1368533 |
| Major Application | peptide synthesis |
| InChI | 1S/C11H13NO2/c1-12(2)10-6-3-9(4-7-10)5-8-11(13)14/h3-8H,1-2H3,(H,13,14)/b8-5+ |
| InChIKey | CQNPVMCASGWEHM-VMPITWQZSA-N |
| SMILES | CN(C)c1ccc(\C=C\C(O)=O)cc1 |
| CAS DataBase Reference | 1552-96-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-(p-(Dimethylamino)phenyl)acrylic acid(1552-96-1) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | T |
| HS Code | 29224985 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




