A3218512
Dimidium bromide , 95% , 518-67-2
Synonym(s):
3,8-Diamino-5-methyl- 6-phenylphenanthridinium bromide;3,8-Diamino-5-methyl-6-phenylphenanthridinium bromide;Dimidium bromide;phenanthridinium 1553;Trypadine
CAS NO.：518-67-2
Empirical Formula: C20H18BrN3
Molecular Weight: 380.28
MDL number: MFCD00011757
EINECS: 208-256-7
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB318.40 | In Stock |
|
| 1G | RMB1003.20 | In Stock |
|
| 5G | RMB3762.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 243-248 °C(lit.) |
| bulk density | 380kg/m3 |
| storage temp. | Store below +30°C. |
| solubility | Methanol (Slightly), Water (Slightly) |
| form | Powder |
| color | Dark red to purple |
| Water Solubility | Soluble in water. |
| λmax | 523-528 nm in methanol |
| BRN | 3809779 |
| InChI | InChI=1S/C20H17N3.BrH/c1-23-19-12-15(22)8-10-17(19)16-9-7-14(21)11-18(16)20(23)13-5-3-2-4-6-13;/h2-12,22H,21H2,1H3;1H |
| InChIKey | MQOKYEROIFEEBH-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=CC=C2)[N+](C)=C2C(C=CC(N)=C2)=C2C=CC(N)=CC=12.[Br-] |
| CAS DataBase Reference | 518-67-2(CAS DataBase Reference) |
Description and Uses
Dimidium bromide acts as an inhibitor of L-cell growth. It is used as fluorescent probe for nucleic acids and as interchelating agent. It is also useful in the determination of cationic surfactants.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-40 |
| Safety Statements | 26-36-22 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | SF7960500 |
| F | 3-8-10 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29339900 |
| Toxicity | LD50 intravenous in mouse: 7300ug/kg |
