A3219012
2′,6′-Dihydroxyacetophenone , 99% , 699-83-2
Synonym(s):
2-Acetyl-1,3-dihydroxybenzene;2-Acetylresorcinol;DHAP
CAS NO.:699-83-2
Empirical Formula: C8H8O3
Molecular Weight: 152.15
MDL number: MFCD00002270
EINECS: 211-833-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB73.60 | In Stock |
|
| 100G | RMB250.40 | In Stock |
|
| 500g | RMB1238.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 156-158 °C(lit.) |
| Boiling point: | 234.6°C (rough estimate) |
| Density | 1.2143 (rough estimate) |
| refractive index | 1.4447 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | dioxane: 50 mg/mL, clear |
| pka | 9.65±0.10(Predicted) |
| form | Powder |
| color | Yellow-beige |
| Water Solubility | sparingly soluble |
| BRN | 1366061 |
| InChI | InChI=1S/C8H8O3/c1-5(9)8-6(10)3-2-4-7(8)11/h2-4,10-11H,1H3 |
| InChIKey | YPTJKHVBDCRKNF-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=C(O)C=CC=C1O)C |
| LogP | 1.922 (est) |
| CAS DataBase Reference | 699-83-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 2',6'-Dihydroxyacetophenone(699-83-2) |
Description and Uses
Used with diammonium hydrogen citrate for MALDI-MS of PMP-labeled acidic and neutral glycans.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29145000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







