A3220412
2,4-Dichlorophenylhydrazine hydrochloride , 99% , 5446-18-4
CAS NO.：5446-18-4
Empirical Formula: C6H7Cl3N2
Molecular Weight: 213.49
MDL number: MFCD00012929
EINECS: 226-659-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB76.80 | In Stock |
|
| 100G | RMB213.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 220-224 °C(lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Crystalline Powder |
| color | Off-white to light brown |
| Water Solubility | soluble |
| BRN | 3708828 |
| InChI | InChI=1S/C6H6Cl2N2.ClH/c7-4-1-2-6(10-9)5(8)3-4;/h1-3,10H,9H2;1H |
| InChIKey | DDWYGJVFURAIJZ-UHFFFAOYSA-N |
| SMILES | C1(NN)=CC=C(Cl)C=C1Cl.Cl |
| CAS DataBase Reference | 5446-18-4(CAS DataBase Reference) |
Description and Uses
2,4-Dichlorophenylhydrazine hydrochloride was used in the synthesis of pyrazole analogues of curcumin.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36-36/37/39-22 |
| WGK Germany | 3 |
| F | 10 |
| Hazard Note | Harmful/Irritant |
| HazardClass | IRRITANT |
| HS Code | 29280000 |
