A3221212
Dithiodiglycolic acid , 96% , 505-73-7
CAS NO.:505-73-7
Empirical Formula: C4H6O4S2
Molecular Weight: 182.22
MDL number: MFCD00004359
EINECS: 208-019-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB257.60 | In Stock |
|
| 25G | RMB849.60 | In Stock |
|
| 100g | RMB3117.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 128-131 °C(lit.) |
| Boiling point: | 395.6±27.0 °C(Predicted) |
| Density | 1,19 g/cm3 |
| storage temp. | -20°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | pK1:3.32;pK2:4.29 (25°C) |
| color | White to Off-White |
| Water Solubility | very faint turbidity |
| Cosmetics Ingredients Functions | REDUCING |
| InChI | InChI=1S/C4H6O4S2/c5-3(6)1-9-10-2-4(7)8/h1-2H2,(H,5,6)(H,7,8) |
| InChIKey | DLLMHEDYJQACRM-UHFFFAOYSA-N |
| SMILES | S(CC(O)=O)SCC(O)=O |
| LogP | 1.390 (est) |
| CAS DataBase Reference | 505-73-7(CAS DataBase Reference) |
| EPA Substance Registry System | Acetic acid, 2,2'-dithiobis- (505-73-7) |
Description and Uses
Thiodiglycolic acid is a major metabolite of vinyl chloride monomer and ifosfamide (an anti-cancer drug) in human urine. It is used as an analytical reagent for the detection of copper, lead, mercury and silver.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | C,Xi |
| Risk Statements | 34-36/37/38 |
| Safety Statements | 26-36/37/39-45-36 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 2 |
| RTECS | AJ6475000 |
| F | 13 |
| TSCA | TSCA listed |
| HS Code | 2930.90.4950 |
| Storage Class | 11 - Combustible Solids |







