A3224312
Diphenyl Phthalate , Analysis of standard products, ≥99.5%(GC) , 84-62-8
Synonym(s):
Phenyl phthalate
CAS NO.:84-62-8
Empirical Formula: C20H14O4
Molecular Weight: 318.32
MDL number: MFCD00003038
EINECS: 201-546-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 74-76 °C(lit.) |
| Boiling point: | 400-405°C |
| Density | 1,28 g/cm3 |
| refractive index | 1.5400 (estimate) |
| Flash point: | 224°C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Crystalline |
| Specific Gravity | approximate 1.28 (20℃) |
| color | White |
| Water Solubility | 82ug/L(24 ºC) |
| Merck | 14,7306 |
| BRN | 2473390 |
| Major Application | agriculture cleaning products cosmetics environmental food and beverages personal care |
| InChI | 1S/C20H14O4/c21-19(23-15-9-3-1-4-10-15)17-13-7-8-14-18(17)20(22)24-16-11-5-2-6-12-16/h1-14H |
| InChIKey | DWNAQMUDCDVSLT-UHFFFAOYSA-N |
| SMILES | O=C(Oc1ccccc1)c2ccccc2C(=O)Oc3ccccc3 |
| CAS DataBase Reference | 84-62-8(CAS DataBase Reference) |
| EPA Substance Registry System | Diphenyl phthalate (84-62-8) |
Description and Uses
Plasticizer in nitrocellulose lacquers.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H400 |
| Precautionary statements | P261-P264-P271-P273-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-26 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 2 |
| RTECS | TI1935000 |
| TSCA | TSCA listed |
| HazardClass | 9 |
| HS Code | 29173490 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |




