A3225012
Diphenyltin dichloride , Analysis standard , 1135-99-5
Synonym(s):
Dichlorodiphenyltin
CAS NO.：1135-99-5
Empirical Formula: C12H10Cl2Sn
Molecular Weight: 343.82
MDL number: MFCD00000516
EINECS: 214-496-3
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB423.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 41-43 °C (lit.) |
| Boiling point: | 333-337 °C (lit.) |
| Flash point: | >230 °F |
| solubility | Sparingly Soluble (2.4E-3 g/L) (25°C), Calc. |
| form | Crystalline |
| color | White |
| Sensitive | Moisture Sensitive |
| Exposure limits | ACGIH: TWA 0.1 mg/m3; STEL 0.2 mg/m3 (Skin) NIOSH: IDLH 25 mg/m3; TWA 0.1 mg/m3 |
| Stability: | Hygroscopic |
| InChI | 1S/2C6H5.2ClH.Sn/c2*1-2-4-6-5-3-1;;;/h2*1-5H;2*1H;/q;;;;+2/p-2 |
| InChIKey | ISXUHJXWYNONDI-UHFFFAOYSA-L |
| SMILES | Cl[Sn](Cl)(c1ccccc1)c2ccccc2 |
| CAS DataBase Reference | 1135-99-5(CAS DataBase Reference) |
| EPA Substance Registry System | Stannane, dichlorodiphenyl- (1135-99-5) |
Description and Uses
Used in the manufacture of chemicals.
Safety
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335-H400 |
| Precautionary statements | P273-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-37/39 |
| RIDADR | UN 3146 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | WH7253000 |
| TSCA | No |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29319090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
