A3227412
Dichloroprop-P , Analysis standard , 15165-67-0
Synonym(s):
(R)-(+)-2-(2,4-Dichlorophenoxy)propionic acid
CAS NO.:15165-67-0
Empirical Formula: C9H8Cl2O3
Molecular Weight: 235.06
MDL number: MFCD00144036
EINECS: 403-980-1
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 124° |
| alpha | 21D +26.6° (c = 1.23 in ethanol) |
| Boiling point: | 348.3±27.0 °C(Predicted) |
| Density | 1.421±0.06 g/cm3(Predicted) |
| Flash point: | 2 °C |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 3.03±0.10(Predicted) |
| Appearance | Light brown to brown Solid |
| Merck | 13,3104 |
| BRN | 5265110 |
| Major Application | agriculture environmental |
| InChI | InChI=1S/C9H8Cl2O3/c1-5(9(12)13)14-8-3-2-6(10)4-7(8)11/h2-5H,1H3,(H,12,13)/t5-/m1/s1 |
| InChIKey | MZHCENGPTKEIGP-RXMQYKEDSA-N |
| SMILES | C(O)(=O)[C@H](OC1=CC=C(Cl)C=C1Cl)C |
| LogP | 2.780 (est) |
| EPA Substance Registry System | (R)-Dichlorprop (15165-67-0) |
Description and Uses
Herbicide.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H317-H318 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn,F |
| Risk Statements | 22-38-41-43-36-20/21/22-11 |
| Safety Statements | 24-26-37/39-36-16-36/37 |
| RIDADR | UN1648 3/PG 2 |
| WGK Germany | 1 |
| RTECS | UA2458860 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 Skin Sens. 1 |






