PRODUCT Properties
| Melting point: | 105℃ |
| Boiling point: | 413.0±28.0 °C(Predicted) |
| Density | 1.1606 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| pka | 3.78±0.41(Predicted) |
| Water Solubility | 16mg/L(room temperature) |
| Merck | 13,3376 |
| BRN | 614796 |
| Major Application | agriculture environmental |
| InChI | 1S/C11H21N5S/c1-6-17-11-15-9(12-7(2)3)14-10(16-11)13-8(4)5/h7-8H,6H2,1-5H3,(H2,12,13,14,15,16) |
| InChIKey | NPWMZOGDXOFZIN-UHFFFAOYSA-N |
| SMILES | CCSc1nc(NC(C)C)nc(NC(C)C)n1 |
| EPA Substance Registry System | Dipropetryn (4147-51-7) |
Description and Uses
Preemergence herbicide used to control weeds in cotton and melon crops.
Safety
| Symbol(GHS) |  GHS09 |
| Hazard statements | H411 |
| PPE | Eyeshields, Gloves |
| Hazard Codes | N |
| Risk Statements | 51/53 |
| Safety Statements | 60 |
| RIDADR | UN3077 9/PG 3 |
| WGK Germany | 2 |
| RTECS | XY4100000 |
| Storage Class | 11 - Combustible Solids |
| Toxicity | LC50 (96-hour) for rainbow trout 2.7 mg/L and bluegill sun?sh 1.6 mg/L (Hartley and Kidd, 1987); acute oral LD50 for rats 3,900–5,000 mg/kg (Hartley and Kidd, 1987), 7,144 mg/kg (RTECS, 1985). |
