A3229512
1,4-Dichlorobenzene-d4 , Analysis standard , 3855-82-1
Synonym(s):
Tetradeutero-1,4-dichlorobenzene
| Pack Size | Price | Stock | Quantity |
| 25MG | RMB255.20 | In Stock |
|
| 100MG | RMB719.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 52-54 °C(lit.) |
| Melting point: | 52-54°C |
| Boiling point: | 173°C |
| Boiling point: | 173 °C(lit.) |
| Density | 1.274 g/mL at 25 °C |
| Density | d = 1,34 |
| Flash point: | 150 °F |
| storage temp. | 2-8°C |
| solubility | Chloroform (Sparingly), Hexane (Slightly), Methanol (Sparingly) |
| form | Solid |
| color | White to off-white |
| BRN | 2047072 |
| Major Application | environmental |
| InChI | 1S/C6H4Cl2/c7-5-1-2-6(8)4-3-5/h1-4H/i1D,2D,3D,4D |
| InChIKey | OCJBOOLMMGQPQU-RHQRLBAQSA-N |
| SMILES | [2H]c1c([2H])c(Cl)c([2H])c([2H])c1Cl |
| CAS DataBase Reference | 3855-82-1(CAS DataBase Reference) |
| EPA Substance Registry System | 1,4-Dichlorobenzene-d4 (3855-82-1) |
| CAS Number Unlabeled | 106-46-7 |
Description and Uses
1,4-Dichlorobenzene-d4 is labelled 1,4-Dichlorobenzene (D431875), a versatile building block and a small bioactive molecule, used in various organic synthesis. It is also used as disinfectant, deodorant, and pesticide.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS07,GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H319-H351-H410 |
| Precautionary statements | P202-P264-P273-P280-P305+P351+P338-P308+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn,N,T,F |
| Risk Statements | 36-40-50/53-39/23/24/25-23/24/25-11-52/53-67-36/37/38 |
| Safety Statements | 36/37-46-60-61-45-24/25-23-26 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| F | 10 |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 28459000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Carc. 2 Eye Irrit. 2 |






