A3229712
all-cis-7,10,13,16,19-Docosapentaenoic acid , Analysis standard , 24880-45-3
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 442.2±24.0 °C(Predicted) |
| Density | 0.932±0.06 g/cm3(Predicted) |
| Flash point: | 14℃ |
| storage temp. | -20°C |
| solubility | 0.1 M Na2CO3: 1.7 mg/ml; DMF: >100 mg/ml; DMSO: >100 mg/ml; Ethanol: Miscible |
| form | liquid |
| pka | 4.76±0.10(Predicted) |
| color | Colorless to light yellow |
| biological source | synthetic |
| InChIKey | YUFFSWGQGVEMMI-JLNKQSITSA-N |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCCC(O)=O |
| EPA Substance Registry System | Docosapentaenoic (24880-45-3) |
Description and Uses
all-cis-7,10,13,16,19-Docosapentaenoic Acid, also known as DPA, is a fatty acid derived from fish oils that potently inhibits platelet aggregation. DPA has been reported to block the cyclooxygenase pathway and stimulate the lipoxygenase pathway, which results in effective platelet aggregation inhibition. Peripheral blood mononuclear cell research demonstrates that DPA diminishes cyclooxygenase-2 levels intracellularly and inhibits pro-inflammatory prostaglandin E2 production.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H319 |
| Precautionary statements | P210-P233-P240-P241-P242-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| RIDADR | UN1170 - class 3 - PG 2 - Ethanol |
| WGK Germany | 2 |
| RTECS | JR1320000 |
| F | 8-10-23 |
| Storage Class | 10 - Combustible liquids |






