A3231512
D-(+)-Galacturonic acid monohydrate , 97% , 91510-62-2
CAS NO.:91510-62-2
Empirical Formula: C6H12O8
Molecular Weight: 212.15
MDL number: MFCD00071585
EINECS: 211-682-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB103.20 | In Stock |
|
| 5G | RMB319.20 | In Stock |
|
| 25G | RMB1156.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 156-159℃ |
| alpha | +51.7°(23℃/D, c=1, H2O) |
| refractive index | 52.5 ° (C=10, H2O) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly, Sonicated), Methanol (Slightly), Water (Slightly) |
| form | Powder |
| color | White to Off-white |
| optical activity | [α]20/D +53±2°, 5 hr, c = 10% in H2O |
| Water Solubility | Soluble in water |
| Merck | 14,4337 |
| BRN | 1727087 |
| InChI | InChI=1/C6H10O7.H2O/c7-1-2(8)4(5(10)11)13-6(12)3(1)9;/h1-4,6-9,12H,(H,10,11);1H2/t1-,2+,3+,4-,6;/s3 |
| InChIKey | BGHPCEJXDOGRGW-LOIFHAGZNA-N |
| SMILES | [C@H]1(C(=O)O)OC([C@H](O)[C@@H](O)[C@H]1O)O.O |&1:0,6,8,10,r| |
| CAS DataBase Reference | 91510-62-2(CAS DataBase Reference) |
Description and Uses
D-(+)-Galacturonic acid monohydrate is a chemical used in the synthesis of N-(D-galacturonoyl) amino acids and dipeptides.



