A3233812
Dicyclopentadiene diepoxide , 97% , 81-21-0
Synonym(s):
Dicyclopentadiene diepoxide
CAS NO.:81-21-0
Empirical Formula: C10H12O2
Molecular Weight: 164.2
MDL number: MFCD00077209
EINECS: 201-334-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB334.40 | In Stock |
|
| 25G | RMB1413.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 185-189 °C(lit.) |
| Boiling point: | 120°C 10mm |
| Density | 1,331 g/cm3 |
| refractive index | 1.5460 (estimate) |
| Flash point: | 120°C/10mm subl. |
| storage temp. | 2-8°C |
| form | Crystals or Crystalline Powder |
| color | White to yellow-beige |
| Water Solubility | Soluble in water. |
| BRN | 112743 |
| InChI | InChI=1S/C10H12O2/c1-4-3-2-6-10(11-6)7(3)5(1)9-8(4)12-9/h3-10H,1-2H2 |
| InChIKey | BQQUFAMSJAKLNB-UHFFFAOYSA-N |
| SMILES | O1C2CC3C(C12)C1CC3C2C1O2 |
| CAS DataBase Reference | 81-21-0(CAS DataBase Reference) |
| EPA Substance Registry System | 2,4-Methano-2H-indeno[1,2-b:5,6-b']bisoxirene, octahydro- (81-21-0) |
Description and Uses
Dicyclopentadiene diepoxide acts as an intermediate for epoxy resins, plasticizers and protective coatings. It finds application as a rubber additive and adhesives, which is used at high temperature. Further, it is used in the preparation of endo-3-hydroxy-exo-9-oxa-exo-tetracyclo[5.3.1.02,6.08,10]undecane using lithium aluminum hydride as a reagent.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H319 |
| Precautionary statements | P280f-P309-P310-P301+P310-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-36 |
| Safety Statements | 26 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | PB9625200 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| HS Code | 29109000 |
| Storage Class | 6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 |
| Hazardous Substances Data | 81-21-0(Hazardous Substances Data) |
| Toxicity | LD50 orl-rat: 210 mg/kg UCDS** 10/5/61 |







