A3240212
3,4-Dichlorobenzonitrile , 97% , 6574-99-8
CAS NO.：6574-99-8
Empirical Formula: C7H3Cl2N
Molecular Weight: 172.01
MDL number: MFCD00016379
EINECS: 229-494-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB43.20 | In Stock |
|
| 25G | RMB148.80 | In Stock |
|
| 100G | RMB453.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 74-78 °C (lit.) |
| Boiling point: | 129-130 °C(Press: 0.01 Torr) |
| Density | 1.40±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| Water Solubility | Insoluble in water |
| form | Powder or Crystalline Powder |
| color | White to brown |
| BRN | 2326352 |
| InChI | InChI=1S/C7H3Cl2N/c8-6-2-1-5(4-10)3-7(6)9/h1-3H |
| InChIKey | KUWBYWUSERRVQP-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=C(Cl)C(Cl)=C1 |
| LogP | 2.8 at 21.5℃ |
| CAS DataBase Reference | 6574-99-8(CAS DataBase Reference) |
| NIST Chemistry Reference | 3,4-Dichlorobenzonitrile(6574-99-8) |
Description and Uses
3,4-Dichlorobenzonitrilemay be used in the preparation of:
- 3,4-difluorobenzonitrile
- 3-chloro-4-fluorobenzonitrile
- 5-chloromethyl-3-( 3,4-dichlorophenyl)isoxazole
- N-[3-(2-pyridyl)isoquinolin-1-yl]-3,4-dichlorobenzamidine
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn,T,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 3276 |
| WGK Germany | 2 |
| Hazard Note | Irritant/Toxic |
| TSCA | N |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
