A3245112
2,6-Diacetylpyridine , 99% , 1129-30-2
Synonym(s):
1-(6-Acetylpyridin-2-yl)ethanone;1,1′-(2,6-Pyridinediyl)diethanone
CAS NO.：1129-30-2
Empirical Formula: C9H9NO2
Molecular Weight: 163.17
MDL number: MFCD00006304
EINECS: 214-442-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB53.60 | In Stock |
|
| 5G | RMB175.20 | In Stock |
|
| 25G | RMB709.60 | In Stock |
|
| 100G | RMB2355.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 79-82 °C (lit.) |
| Boiling point: | 126 °C / 6mmHg |
| Density | 1.2021 (rough estimate) |
| refractive index | 1.5300 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Crystalline Needles or Powder |
| pka | 0.88±0.10(Predicted) |
| color | White to off-white |
| Water Solubility | Soluble in water, chloroform, and DMSO. |
| BRN | 118286 |
| InChI | InChI=1S/C9H9NO2/c1-6(11)8-4-3-5-9(10-8)7(2)12/h3-5H,1-2H3 |
| InChIKey | BEZVGIHGZPLGBL-UHFFFAOYSA-N |
| SMILES | C1(C(=O)C)=NC(C(=O)C)=CC=C1 |
| LogP | 1.319 (est) |
| CAS DataBase Reference | 1129-30-2(CAS DataBase Reference) |
Description and Uses
2,6-Diacetylpyridine is used as intermediate in organic synthesis. It is a precursor to ligands in coordination chemistry.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,F |
| Risk Statements | 36/37/38-15-10 |
| Safety Statements | 26-36-43-7/8 |
| WGK Germany | 3 |
| F | 10 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
