A3245412
4,6-Dichloropyrimidine-5-carboxaldehyde , 97% , 5305-40-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB94.40 | In Stock |
|
| 25G | RMB359.20 | In Stock |
|
| 100g | RMB1263.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 66-71 °C |
| Boiling point: | 92-93 °C(Press: 0.05 Torr) |
| Density | 1.588±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | solid |
| pka | -5.90±0.26(Predicted) |
| color | Yellow |
| InChI | InChI=1S/C5H2Cl2N2O/c6-4-3(1-10)5(7)9-2-8-4/h1-2H |
| InChIKey | XQSJHQXYQAUDFC-UHFFFAOYSA-N |
| SMILES | C1=NC(Cl)=C(C=O)C(Cl)=N1 |
| CAS DataBase Reference | 5305-40-8(CAS DataBase Reference) |
Description and Uses
4,6-Dichloropyrimidine-5-carboxaldehyde is used as a substrate in the synthesis of N-terminal surrogate in amino acid and peptide analogues.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H317-H319 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-43-36/38-22 |
| Safety Statements | 26-36-36/37 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29335990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |



