PRODUCT Properties
| Melting point: | 121-122 °C (lit.) |
| Boiling point: | 307°C(lit.) |
| Density | 1.407±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| pka | -1.49±0.50(Predicted) |
| color | Light yellow to Brown to Dark green |
| InChI | InChI=1S/C9H5Cl2N/c10-8-5-6-3-1-2-4-7(6)9(11)12-8/h1-5H |
| InChIKey | BRGZEQXWZWBPJH-UHFFFAOYSA-N |
| SMILES | C1(Cl)C2=C(C=CC=C2)C=C(Cl)N=1 |
| CAS DataBase Reference | 7742-73-6(CAS DataBase Reference) |
Description and Uses
1,3-Dichloroisoquinoline may be used in the facile synthesis of 1,3,4-trisubstituted isoquinoline derivatives.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29163990 |
