A3250212
(-)-Di-p-anisoyl-L-tartaric Acid , 97% , 50583-51-2
CAS NO.:50583-51-2
Empirical Formula: C20H18O10
Molecular Weight: 418.35
MDL number: MFCD02682986
EINECS: 672-585-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB68.80 | In Stock |
|
| 100G | RMB155.20 | In Stock |
|
| 500g | RMB691.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 193-195°C |
| alpha | -167 º (c=1,EtOH) |
| Boiling point: | 681.6±55.0 °C(Predicted) |
| Density | 1.407±0.06 g/cm3(Predicted) |
| refractive index | -168 ° (C=1, EtOH) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Ethanol (Slightly), Methanol (Slightly) |
| pka | 1.48±0.25(Predicted) |
| form | Solid |
| color | White to Off-White |
| optical activity | Consistent with structure |
| InChI | InChI=1S/C20H18O10/c1-27-13-7-3-11(4-8-13)19(25)29-15(17(21)22)16(18(23)24)30-20(26)12-5-9-14(28-2)10-6-12/h3-10,15-16H,1-2H3,(H,21,22)(H,23,24)/t15-,16-/m1/s1 |
| InChIKey | KWWCVCFQHGKOMI-HZPDHXFCSA-N |
| SMILES | C(O)(=O)[C@H](OC(=O)C1=CC=C(OC)C=C1)[C@@H](OC(=O)C1=CC=C(OC)C=C1)C(O)=O |
| CAS DataBase Reference | 50583-51-2(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| HS Code | 2917.39.7000 |
| REACH Registrations | Active |




