A3251312
Dibutyl phthalate Standard , 160.0-195.0 μg/ml, solvent: methanol , 84-74-2
Synonym(s):
DBP;Dibutyl phthalate;Red 2;Phthalic acid dibutyl ester;Dibenzo{[f,f′]-4,4′,7,7′-tetraphenyl}diindeno[1,2,3-cd:1′,2′,3′-lm]perylene
CAS NO.:84-74-2
Empirical Formula: C16H22O4
Molecular Weight: 278.34
MDL number: MFCD00009441
EINECS: 201-557-4
| Pack Size | Price | Stock | Quantity |
| 2ML | RMB239.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -35 °C (lit.) |
| Boiling point: | 340 °C (lit.) |
| Density | 1.043 g/mL at 25 °C (lit.) |
| vapor density | 9.6 (vs air) |
| vapor pressure | 1 mm Hg ( 147 °C) |
| refractive index | n |
| Flash point: | 340 °F |
| storage temp. | 2-8°C |
| solubility | Very soluble in alcohol, ether, acetone, benzene |
| form | Liquid |
| pka | 3.79 |
| color | APHA: ≤10 |
| Specific Gravity | 1.049 (20/20℃) |
| Relative polarity | 0.272 |
| Odor | odorless |
| PH | 7 (20°C, 10mg/L) |
| explosive limit | 0.47%, 236°F |
| Water Solubility | Slightly soluble. 0.0013 g/100 mL |
| FreezingPoint | -35℃ |
| Merck | 14,3035 |
| BRN | 1914064 |
| Henry's Law Constant | 6.3 x 10-5 atmm3/mol (quoted, Petrasek et al., 1983) |
| Dielectric constant | 6.0(45℃) |
| Exposure limits | NIOSH REL: TWA 5 mg/m3, IDLH 4,000 mg/m3; OSHA PEL: TWA
5 mg/m3; ACGIH TLV: TWA 5 mg/m3. |
| Cosmetics Ingredients Functions | PERFUMING FRAGRANCE PLASTICISER SOLVENT |
| Cosmetic Ingredient Review (CIR) | Dibutyl phthalate (84-74-2) |
| InChI | 1S/C16H22O4/c1-3-5-11-19-15(17)13-9-7-8-10-14(13)16(18)20-12-6-4-2/h7-10H,3-6,11-12H2,1-2H3 |
| InChIKey | DOIRQSBPFJWKBE-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)c1ccccc1C(=O)OCCCC |
| LogP | 4.46-4.57 at 20-30℃ |
| CAS DataBase Reference | 84-74-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Dibutyl phthalate(84-74-2) |
| EPA Substance Registry System | Dibutyl phthalate (84-74-2) |
Description and Uses
Dibutyl phthalate is included as an insect repellent in some aerosol sprays used to treat flystrike in sheep. It is colorless oily liquid with a very weak aromatic odor.
Di-n-butyl phthalate has been used as an insect repellant.
Safety
| Symbol(GHS) | ![]() ![]() GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H360FD-H410 |
| Precautionary statements | P201-P273-P308+P313 |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | T,N,F |
| Risk Statements | 61-50-62-39/23/24/25-23/24/25-11 |
| Safety Statements | 53-45-61-36/37-16 |
| RIDADR | UN 3082 9/PG 3 |
| OEB | B |
| OEL | TWA: 5 mg/m3 |
| WGK Germany | 2 |
| RTECS | TI0875000 |
| Autoignition Temperature | 756 °F |
| TSCA | TSCA listed |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29173100 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 2 Repr. 1B |
| Hazardous Substances Data | 84-74-2(Hazardous Substances Data) |
| Toxicity | Acute oral LD50 for rats 8,000 mg/kg (RTECS, 1985). |
| IDLA | 4,000 mg/m3 |




