A3252912
4,4′-Di-tert-butyl-2,2′-dipyridyl , 98% , 72914-19-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB94.40 | In Stock |
|
| 5G | RMB340.00 | In Stock |
|
| 25G | RMB1519.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 159-161 °C(lit.) |
| Boiling point: | 395.4±42.0 °C(Predicted) |
| Density | 0.977 |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | crystal |
| pka | 5.15±0.30(Predicted) |
| color | white |
| Stability: | hygroscopic |
| InChI | InChI=1S/C18H24N2/c1-17(2,3)13-7-9-19-15(11-13)16-12-14(8-10-20-16)18(4,5)6/h7-12H,1-6H3 |
| InChIKey | TXNLQUKVUJITMX-UHFFFAOYSA-N |
| SMILES | C1(C2=NC=CC(C(C)(C)C)=C2)=NC=CC(C(C)(C)C)=C1 |
Description and Uses
4,4'-Di-tert-butyl-2,2'-dipyridyl acts as a reagent in the preparation, antiproliferative and cytotoxic activity of apoptotic ruthenium nitrogen heterocyclic complexes via combinatorial library synthesis.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301+H311 |
| Precautionary statements | P264-P270-P280-P301+P310-P302+P352+P312-P361+P364 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | No |
| HS Code | 29333990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Oral |
