A3253412
                    4,7-Dimethyl-1,10-phenanthroline , 98% , 3248-05-3
CAS NO.:3248-05-3
Empirical Formula: C14H12N2
Molecular Weight: 208.26
MDL number: MFCD00004979
EINECS: 221-827-5
| Pack Size | Price | Stock | Quantity | 
| 250MG | RMB96.80 | In Stock | 
                                                 | 
                                        
| 1G | RMB319.20 | In Stock | 
                                                 | 
                                        
| 5G | RMB1400.00 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | 193-195 °C(lit.) | 
                                    
| Boiling point: | 338.63°C (rough estimate) | 
                                    
| Density | 1.1202 (rough estimate) | 
                                    
| refractive index | 1.6152 (estimate) | 
                                    
| Flash point: | 177.00°C | 
                                    
| storage temp. | Sealed in dry,Room Temperature | 
                                    
| pka | 6.01±0.10(Predicted) | 
                                    
| form | powder to crystal | 
                                    
| color | White to Gray to Brown | 
                                    
| Water Solubility | Soluble in benzene and alcohol. Slightly soluble in water. | 
                                    
| InChI | InChI=1S/C14H12N2/c1-9-5-7-15-13-11(9)3-4-12-10(2)6-8-16-14(12)13/h3-8H,1-2H3 | 
                                    
| InChIKey | JIVLDFFWTQYGSR-UHFFFAOYSA-N | 
                                    
| SMILES | N1C2C(=CC=C3C=2N=CC=C3C)C(C)=CC=1 | 
                                    
| CAS DataBase Reference | 3248-05-3(CAS DataBase Reference) | 
                                    
| NIST Chemistry Reference | 4,7-Dimethyl-1,10-phenanthroline(3248-05-3) | 
                                    
| EPA Substance Registry System | 1,10-Phenanthroline, 4,7-dimethyl- (3248-05-3) | 
                                    
Description and Uses
4,7-Dimethyl-1,10-phenanthroline acts as an intermediate in synthetic chemistry and dyestuff field. It is also used as an organic bidentate ligand and form complexes with metal for detection. Further, it plays an important role in colorimetric sensors, coordination polymer, ionochromism and luminescence.
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H302-H315-H319-H335 | 
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a | 
| Hazard Codes | Xn | 
| Risk Statements | 36/37/38-22 | 
| Safety Statements | 26-36/37/39-24/25 | 
| WGK Germany | 3 | 
| TSCA | Yes | 
| HS Code | 29339900 | 




