A3254012
4,4'-Dihydroxydiphenyl Ether , >97.0%(GC) , 1965-09-9
CAS NO.:1965-09-9
Empirical Formula: C12H10O3
Molecular Weight: 202.21
MDL number: MFCD00016463
EINECS: 217-809-1
| Pack Size | Price | Stock | Quantity |
| 5g | RMB27.20 | In Stock |
|
| 25G | RMB84.80 | In Stock |
|
| 100G | RMB311.20 | In Stock |
|
| 500G | RMB1244.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 163-168 °C |
| Boiling point: | 300.32°C (rough estimate) |
| Density | 1.1868 (rough estimate) |
| refractive index | 1.5430 (estimate) |
| storage temp. | Room Temperature |
| solubility | DMSO (Sparingly), Methanol (Slightly) |
| pka | 9.90±0.15(Predicted) |
| form | Amorphous Powder |
| color | Off-white |
| InChI | InChI=1S/C12H10O3/c13-9-1-5-11(6-2-9)15-12-7-3-10(14)4-8-12/h1-8,13-14H |
| InChIKey | NZGQHKSLKRFZFL-UHFFFAOYSA-N |
| SMILES | O(C1=CC=C(O)C=C1)C1=CC=C(O)C=C1 |
| CAS DataBase Reference | 1965-09-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Phenol, 4,4'-oxybis-(1965-09-9) |
| EPA Substance Registry System | Phenol, 4,4'-oxybis- (1965-09-9) |
Description and Uses
4,4'-Oxydiphenol can be used as a pharmaceutical intermediates.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Safety Statements | 24/25 |
| RTECS | SM6040000 |
| TSCA | TSCA listed |
| HS Code | 29095000 |
| Toxicity | LD50 ipr-mus: 150 mg/kg NTIS** AD691-490 |




