A3254612
2,3-Dichloropyridine , 99% , 2402-77-9
CAS NO.:2402-77-9
Empirical Formula: C5H3Cl2N
Molecular Weight: 147.99
MDL number: MFCD00006229
EINECS: 219-281-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB40.80 | In Stock |
|
| 100G | RMB97.60 | In Stock |
|
| 500g | RMB352.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 64-67 °C (lit.) |
| Boiling point: | 242.42°C (rough estimate) |
| Density | 1.5159 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | -0.63±0.10(Predicted) |
| form | Crystalline Powder |
| color | White to slightly beige |
| Water Solubility | slightly soluble |
| BRN | 109811 |
| InChI | InChI=1S/C5H3Cl2N/c6-4-2-1-3-8-5(4)7/h1-3H |
| InChIKey | MAKFMOSBBNKPMS-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=CC=C1Cl |
| CAS DataBase Reference | 2402-77-9(CAS DataBase Reference) |
Description and Uses
2,3-Dichloropyridine is used as a reagent for the preparation of substituted 3-(5-membered heterocycle-carboxamido)pyridine derivatives for treatment of autoimmune and inflammatory diseases. Also in the synthesis, crystal structure and biological activity of novel anthranilic Diamide insecticide with propargyl ether.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36-37/39 |
| RIDADR | UN2811 |
| WGK Germany | 3 |
| RTECS | US8050000 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| HS Code | 29333999 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






