PRODUCT Properties
| Melting point: | 65-67 °C (lit.) |
| Boiling point: | 178 °C |
| Density | 1.39 |
| Flash point: | >110°C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform, Ethyl Acetate |
| form | Solid |
| pka | 0.32±0.10(Predicted) |
| color | White to Off-White |
| BRN | 1973 |
| InChI | InChI=1S/C5H3Cl2N/c6-4-1-5(7)3-8-2-4/h1-3H |
| InChIKey | WPGHPGAUFIJVJF-UHFFFAOYSA-N |
| SMILES | C1=NC=C(Cl)C=C1Cl |
| CAS DataBase Reference | 2457-47-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Pyridine, 3,5-dichloro-(2457-47-8) |
Description and Uses
3,5-Dichloropyridine (cas# 2457-47-8) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-37/38-41-36/37/38 |
| Safety Statements | 26-39-36 |
| RIDADR | UN2811 |
| WGK Germany | 3 |
| RTECS | US8575000 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| HS Code | 29333990 |
