A3258112
10,11-Dihydro-5H-dibenzo[b,f]azepine-5-carbonyl Chloride , 98% , 33948-19-5
CAS NO.:33948-19-5
Empirical Formula: C15H12ClNO
Molecular Weight: 257.71
MDL number: MFCD00012314
EINECS: 251-756-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB319.20 | In Stock |
|
| 25G | RMB1039.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 121-124 °C(lit.) |
| Boiling point: | 397.5±42.0 °C(Predicted) |
| Density | 1.282±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | powder to crystal |
| pka | -3.07±0.20(Predicted) |
| color | White to Light yellow |
| InChI | InChI=1S/C15H12ClNO/c16-15(18)17-13-7-3-1-5-11(13)9-10-12-6-2-4-8-14(12)17/h1-8H,9-10H2 |
| InChIKey | COHHZMJBMIHLGF-UHFFFAOYSA-N |
| SMILES | C(Cl)(N1C2=CC=CC=C2CCC2=CC=CC=C12)=O |
| CAS DataBase Reference | 33948-19-5(CAS DataBase Reference) |
Description and Uses
Carbamazepine intermediate.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H290-H314 |
| Precautionary statements | P234-P260-P264-P280-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P390-P405-P406-P501 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29163990 |

![10,11-Dihydro-5H-dibenzo[b,f]azepine-5-carbonyl Chloride](https://img.chemicalbook.com/CAS/GIF/33948-19-5.gif)

![10-Bromo-5H-dibenzo[b,f]azepine-5-carboxamide](https://img.chemicalbook.com/CAS/GIF/59690-97-0.gif)



